C21H15ClF3NO5S — CID 91383312
[3-[2-chloro-4-(pyridin-2-ylmethylsulfonyl)phenoxy]-5-(trifluoromethyl)phenyl] acetate (PubChem CID 91383312) has the molecular formula C21H15ClF3NO5S and a molecular weight of 485.87 g/mol. Its IUPAC name is [3-[2-chloro-4-(pyridin-2-ylmethylsulfonyl)phenoxy]-5-(trifluoromethyl)phenyl] acetate.
| Compound Name | [3-[2-chloro-4-(pyridin-2-ylmethylsulfonyl)phenoxy]-5-(trifluoromethyl)phenyl] acetate |
|---|---|
| PubChem CID | 91383312 |
| Molecular Formula | C21H15ClF3NO5S |
| Molecular Weight | 485.87 g/mol |
| Exact Mass | 485.03 |
| IUPAC Name | [3-[2-chloro-4-(pyridin-2-ylmethylsulfonyl)phenoxy]-5-(trifluoromethyl)phenyl] acetate |
| SMILES | CC(=O)Oc1cc(Oc2ccc(S(=O)(=O)Cc3ccccn3)cc2Cl)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H15ClF3NO5S/c1-13(27)30-16-8-14(21(23,24)25)9-17(10-16)31-20-6-5-18(11-19(20)22)32(28,29)12-15-4-2-3-7-26-15/h2-11H,12H2,1H3 |
| InChIKey | OKNHPGQPVSAQMP-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 82.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.87 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|