C21H19Cl2N4O3S+ — CID 143485401
[(Z)-[1-amino-2-[3-(4-benzylsulfonyl-2-chlorophenoxy)-5-chlorophenyl]ethylidene]hydrazinylidene]azanium (PubChem CID 143485401) has the molecular formula C21H19Cl2N4O3S+ and a molecular weight of 478.38 g/mol. Its IUPAC name is [(Z)-[1-amino-2-[3-(4-benzylsulfonyl-2-chlorophenoxy)-5-chlorophenyl]ethylidene]hydrazinylidene]azanium.
| Compound Name | [(Z)-[1-amino-2-[3-(4-benzylsulfonyl-2-chlorophenoxy)-5-chlorophenyl]ethylidene]hydrazinylidene]azanium |
|---|---|
| PubChem CID | 143485401 |
| Molecular Formula | C21H19Cl2N4O3S+ |
| Molecular Weight | 478.38 g/mol |
| Exact Mass | 477.05 |
| IUPAC Name | [(Z)-[1-amino-2-[3-(4-benzylsulfonyl-2-chlorophenoxy)-5-chlorophenyl]ethylidene]hydrazinylidene]azanium |
| SMILES | N/C(Cc1cc(Cl)cc(Oc2ccc(S(=O)(=O)Cc3ccccc3)cc2Cl)c1)=N\N=[NH2+] |
| InChI | InChI=1S/C21H18Cl2N4O3S/c22-16-8-15(10-21(24)26-27-25)9-17(11-16)30-20-7-6-18(12-19(20)23)31(28,29)13-14-4-2-1-3-5-14/h1-9,11-12H,10,13H2,(H3,24,25,26)/p+1 |
| InChIKey | BZFVFEQYFMJPOH-UHFFFAOYSA-O |
| XLogP | 3.79 |
| TPSA | 119.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.38 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|