C19H17ClF3NO5S — CID 69162625
2-[3-(2-chloro-4-methylsulfonylphenoxy)-5-(trifluoromethyl)phenyl]-3-(dimethylamino)prop-2-enoic acid (PubChem CID 69162625) has the molecular formula C19H17ClF3NO5S and a molecular weight of 463.86 g/mol. Its IUPAC name is 2-[3-(2-chloro-4-methylsulfonylphenoxy)-5-(trifluoromethyl)phenyl]-3-(dimethylamino)prop-2-enoic acid.
| Compound Name | 2-[3-(2-chloro-4-methylsulfonylphenoxy)-5-(trifluoromethyl)phenyl]-3-(dimethylamino)prop-2-enoic acid |
|---|---|
| PubChem CID | 69162625 |
| Molecular Formula | C19H17ClF3NO5S |
| Molecular Weight | 463.86 g/mol |
| Exact Mass | 463.05 |
| IUPAC Name | 2-[3-(2-chloro-4-methylsulfonylphenoxy)-5-(trifluoromethyl)phenyl]-3-(dimethylamino)prop-2-enoic acid |
| SMILES | CN(C)C=C(C(=O)O)c1cc(Oc2ccc(S(C)(=O)=O)cc2Cl)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H17ClF3NO5S/c1-24(2)10-15(18(25)26)11-6-12(19(21,22)23)8-13(7-11)29-17-5-4-14(9-16(17)20)30(3,27)28/h4-10H,1-3H3,(H,25,26) |
| InChIKey | DBMADTQNPSTHJY-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.86 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|