C25H30N6O3 — CID 91383643
3-[[2,4-bis(3-methylmorpholin-4-yl)pyrido[2,3-d]pyrimidin-7-yl]methyl]benzamide (PubChem CID 91383643) has the molecular formula C25H30N6O3 and a molecular weight of 462.55 g/mol. Its IUPAC name is 3-[[2,4-bis(3-methylmorpholin-4-yl)pyrido[2,3-d]pyrimidin-7-yl]methyl]benzamide.
| Compound Name | 3-[[2,4-bis(3-methylmorpholin-4-yl)pyrido[2,3-d]pyrimidin-7-yl]methyl]benzamide |
|---|---|
| PubChem CID | 91383643 |
| Molecular Formula | C25H30N6O3 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.24 |
| IUPAC Name | 3-[[2,4-bis(3-methylmorpholin-4-yl)pyrido[2,3-d]pyrimidin-7-yl]methyl]benzamide |
| SMILES | CC1COCCN1c1nc(N2CCOCC2C)c2ccc(Cc3cccc(C(N)=O)c3)nc2n1 |
| InChI | InChI=1S/C25H30N6O3/c1-16-14-33-10-8-30(16)24-21-7-6-20(13-18-4-3-5-19(12-18)22(26)32)27-23(21)28-25(29-24)31-9-11-34-15-17(31)2/h3-7,12,16-17H,8-11,13-15H2,1-2H3,(H2,26,32) |
| InChIKey | VIYDPKJVAPRZDL-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 106.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |