C20H26N4O — CID 91385388
4-[4-[2-[(4-methyl-2,5-dihydropyridin-2-yl)oxy]ethyl]piperazin-1-yl]-1H-indole (PubChem CID 91385388) has the molecular formula C20H26N4O and a molecular weight of 338.46 g/mol. Its IUPAC name is 4-[4-[2-[(4-methyl-2,5-dihydropyridin-2-yl)oxy]ethyl]piperazin-1-yl]-1H-indole.
| Compound Name | 4-[4-[2-[(4-methyl-2,5-dihydropyridin-2-yl)oxy]ethyl]piperazin-1-yl]-1H-indole |
|---|---|
| PubChem CID | 91385388 |
| Molecular Formula | C20H26N4O |
| Molecular Weight | 338.46 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | 4-[4-[2-[(4-methyl-2,5-dihydropyridin-2-yl)oxy]ethyl]piperazin-1-yl]-1H-indole |
| SMILES | CC1=CC(OCCN2CCN(c3cccc4[nH]ccc34)CC2)N=CC1 |
| InChI | InChI=1S/C20H26N4O/c1-16-5-7-22-20(15-16)25-14-13-23-9-11-24(12-10-23)19-4-2-3-18-17(19)6-8-21-18/h2-4,6-8,15,20-21H,5,9-14H2,1H3 |
| InChIKey | VYMUJDXQVUWBMJ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 43.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.46 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|