C23H26F3N3O4 — CID 91387489
1-(1,3-dihydroxy-4,7-dihydroisoindol-2-yl)-3-[4-[2-(2,2,2-trifluoroethoxy)phenyl]piperazin-1-yl]propan-2-one (PubChem CID 91387489) has the molecular formula C23H26F3N3O4 and a molecular weight of 465.47 g/mol. Its IUPAC name is 1-(1,3-dihydroxy-4,7-dihydroisoindol-2-yl)-3-[4-[2-(2,2,2-trifluoroethoxy)phenyl]piperazin-1-yl]propan-2-one.
| Compound Name | 1-(1,3-dihydroxy-4,7-dihydroisoindol-2-yl)-3-[4-[2-(2,2,2-trifluoroethoxy)phenyl]piperazin-1-yl]propan-2-one |
|---|---|
| PubChem CID | 91387489 |
| Molecular Formula | C23H26F3N3O4 |
| Molecular Weight | 465.47 g/mol |
| Exact Mass | 465.19 |
| IUPAC Name | 1-(1,3-dihydroxy-4,7-dihydroisoindol-2-yl)-3-[4-[2-(2,2,2-trifluoroethoxy)phenyl]piperazin-1-yl]propan-2-one |
| SMILES | O=C(CN1CCN(c2ccccc2OCC(F)(F)F)CC1)Cn1c(O)c2c(c1O)CC=CC2 |
| InChI | InChI=1S/C23H26F3N3O4/c24-23(25,26)15-33-20-8-4-3-7-19(20)28-11-9-27(10-12-28)13-16(30)14-29-21(31)17-5-1-2-6-18(17)22(29)32/h1-4,7-8,31-32H,5-6,9-15H2 |
| InChIKey | BFPWLDWDQBVSMZ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 78.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.47 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|