C21H32N2O5 — CID 91388915
N'-[2-[3-(3,5-ditert-butyl-4-hydroxyphenyl)-3-oxopropoxy]ethyl]oxamide (PubChem CID 91388915) has the molecular formula C21H32N2O5 and a molecular weight of 392.50 g/mol. Its IUPAC name is N'-[2-[3-(3,5-ditert-butyl-4-hydroxyphenyl)-3-oxopropoxy]ethyl]oxamide.
| Compound Name | N'-[2-[3-(3,5-ditert-butyl-4-hydroxyphenyl)-3-oxopropoxy]ethyl]oxamide |
|---|---|
| PubChem CID | 91388915 |
| Molecular Formula | C21H32N2O5 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.23 |
| IUPAC Name | N'-[2-[3-(3,5-ditert-butyl-4-hydroxyphenyl)-3-oxopropoxy]ethyl]oxamide |
| SMILES | CC(C)(C)c1cc(C(=O)CCOCCNC(=O)C(N)=O)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C21H32N2O5/c1-20(2,3)14-11-13(12-15(17(14)25)21(4,5)6)16(24)7-9-28-10-8-23-19(27)18(22)26/h11-12,25H,7-10H2,1-6H3,(H2,22,26)(H,23,27) |
| InChIKey | GUVDSYZRDGMGFD-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 118.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|