C28H33N3O4 — CID 91392666
2-[4-[[5-oxo-1-(3-pentylcyclohexanecarbonyl)-1,2,4-triazol-4-yl]methyl]phenyl]benzoic acid (PubChem CID 91392666) has the molecular formula C28H33N3O4 and a molecular weight of 475.59 g/mol. Its IUPAC name is 2-[4-[[5-oxo-1-(3-pentylcyclohexanecarbonyl)-1,2,4-triazol-4-yl]methyl]phenyl]benzoic acid.
| Compound Name | 2-[4-[[5-oxo-1-(3-pentylcyclohexanecarbonyl)-1,2,4-triazol-4-yl]methyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 91392666 |
| Molecular Formula | C28H33N3O4 |
| Molecular Weight | 475.59 g/mol |
| Exact Mass | 475.25 |
| IUPAC Name | 2-[4-[[5-oxo-1-(3-pentylcyclohexanecarbonyl)-1,2,4-triazol-4-yl]methyl]phenyl]benzoic acid |
| SMILES | CCCCCC1CCCC(C(=O)n2ncn(Cc3ccc(-c4ccccc4C(=O)O)cc3)c2=O)C1 |
| InChI | InChI=1S/C28H33N3O4/c1-2-3-4-8-20-9-7-10-23(17-20)26(32)31-28(35)30(19-29-31)18-21-13-15-22(16-14-21)24-11-5-6-12-25(24)27(33)34/h5-6,11-16,19-20,23H,2-4,7-10,17-18H2,1H3,(H,33,34) |
| InChIKey | RCOKBWIAHXFJEP-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 94.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.59 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|