C16H26O3 — CID 91393693
2-acetyl-4-(1-ethoxyethenyl)-3,3,5,5-tetramethylcyclohexan-1-one (PubChem CID 91393693) has the molecular formula C16H26O3 and a molecular weight of 266.38 g/mol. Its IUPAC name is 2-acetyl-4-(1-ethoxyethenyl)-3,3,5,5-tetramethylcyclohexan-1-one.
| Compound Name | 2-acetyl-4-(1-ethoxyethenyl)-3,3,5,5-tetramethylcyclohexan-1-one |
|---|---|
| PubChem CID | 91393693 |
| Molecular Formula | C16H26O3 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.19 |
| IUPAC Name | 2-acetyl-4-(1-ethoxyethenyl)-3,3,5,5-tetramethylcyclohexan-1-one |
| SMILES | C=C(OCC)C1C(C)(C)CC(=O)C(C(C)=O)C1(C)C |
| InChI | InChI=1S/C16H26O3/c1-8-19-11(3)14-15(4,5)9-12(18)13(10(2)17)16(14,6)7/h13-14H,3,8-9H2,1-2,4-7H3 |
| InChIKey | ILUYNPFZQQLRMH-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|