C14H24O2 — CID 141089272
3-(2-ethoxyprop-2-enyl)-3,5,5-trimethylcyclohexan-1-one (PubChem CID 141089272) has the molecular formula C14H24O2 and a molecular weight of 224.34 g/mol. Its IUPAC name is 3-(2-ethoxyprop-2-enyl)-3,5,5-trimethylcyclohexan-1-one.
| Compound Name | 3-(2-ethoxyprop-2-enyl)-3,5,5-trimethylcyclohexan-1-one |
|---|---|
| PubChem CID | 141089272 |
| Molecular Formula | C14H24O2 |
| Molecular Weight | 224.34 g/mol |
| Exact Mass | 224.18 |
| IUPAC Name | 3-(2-ethoxyprop-2-enyl)-3,5,5-trimethylcyclohexan-1-one |
| SMILES | C=C(CC1(C)CC(=O)CC(C)(C)C1)OCC |
| InChI | InChI=1S/C14H24O2/c1-6-16-11(2)7-14(5)9-12(15)8-13(3,4)10-14/h2,6-10H2,1,3-5H3 |
| InChIKey | TUTPJAJEAQYNAS-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.34 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|