C16H17NOS — CID 91395588
methoxymethane;4-methyl-2-phenylthieno[2,3-c]pyridine (PubChem CID 91395588) has the molecular formula C16H17NOS and a molecular weight of 271.39 g/mol. Its IUPAC name is methoxymethane;4-methyl-2-phenylthieno[2,3-c]pyridine.
| Compound Name | methoxymethane;4-methyl-2-phenylthieno[2,3-c]pyridine |
|---|---|
| PubChem CID | 91395588 |
| Molecular Formula | C16H17NOS |
| Molecular Weight | 271.39 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | methoxymethane;4-methyl-2-phenylthieno[2,3-c]pyridine |
| SMILES | COC.Cc1cncc2sc(-c3ccccc3)cc12 |
| InChI | InChI=1S/C14H11NS.C2H6O/c1-10-8-15-9-14-12(10)7-13(16-14)11-5-3-2-4-6-11;1-3-2/h2-9H,1H3;1-2H3 |
| InChIKey | KHKQXMORTIFTBS-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.39 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |