C22H18F3NO6S — CID 91396291
2-ethoxy-5-[(4-phenylphenyl)-(trifluoromethoxy)sulfamoyl]benzoic acid (PubChem CID 91396291) has the molecular formula C22H18F3NO6S and a molecular weight of 481.45 g/mol. Its IUPAC name is 2-ethoxy-5-[(4-phenylphenyl)-(trifluoromethoxy)sulfamoyl]benzoic acid.
| Compound Name | 2-ethoxy-5-[(4-phenylphenyl)-(trifluoromethoxy)sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 91396291 |
| Molecular Formula | C22H18F3NO6S |
| Molecular Weight | 481.45 g/mol |
| Exact Mass | 481.08 |
| IUPAC Name | 2-ethoxy-5-[(4-phenylphenyl)-(trifluoromethoxy)sulfamoyl]benzoic acid |
| SMILES | CCOc1ccc(S(=O)(=O)N(OC(F)(F)F)c2ccc(-c3ccccc3)cc2)cc1C(=O)O |
| InChI | InChI=1S/C22H18F3NO6S/c1-2-31-20-13-12-18(14-19(20)21(27)28)33(29,30)26(32-22(23,24)25)17-10-8-16(9-11-17)15-6-4-3-5-7-15/h3-14H,2H2,1H3,(H,27,28) |
| InChIKey | AJAUFYIOXJKFOC-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.45 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|