C17H35N — CID 91396905
4-hexyl-3,3-dimethyl-1-pentan-2-ylpyrrolidine (PubChem CID 91396905) has the molecular formula C17H35N and a molecular weight of 253.47 g/mol. Its IUPAC name is 4-hexyl-3,3-dimethyl-1-pentan-2-ylpyrrolidine.
| Compound Name | 4-hexyl-3,3-dimethyl-1-pentan-2-ylpyrrolidine |
|---|---|
| PubChem CID | 91396905 |
| Molecular Formula | C17H35N |
| Molecular Weight | 253.47 g/mol |
| Exact Mass | 253.28 |
| IUPAC Name | 4-hexyl-3,3-dimethyl-1-pentan-2-ylpyrrolidine |
| SMILES | CCCCCCC1CN(C(C)CCC)CC1(C)C |
| InChI | InChI=1S/C17H35N/c1-6-8-9-10-12-16-13-18(14-17(16,4)5)15(3)11-7-2/h15-16H,6-14H2,1-5H3 |
| InChIKey | FERLDWFYJLQCIQ-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.47 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|