C22H23N3O2S — CID 91396947
2-amino-N-[(3-hydroxyphenyl)-thiophen-2-ylmethyl]-6-(3-methylbut-2-enyl)pyridine-3-carboxamide (PubChem CID 91396947) has the molecular formula C22H23N3O2S and a molecular weight of 393.51 g/mol. Its IUPAC name is 2-amino-N-[(3-hydroxyphenyl)-thiophen-2-ylmethyl]-6-(3-methylbut-2-enyl)pyridine-3-carboxamide.
| Compound Name | 2-amino-N-[(3-hydroxyphenyl)-thiophen-2-ylmethyl]-6-(3-methylbut-2-enyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 91396947 |
| Molecular Formula | C22H23N3O2S |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | 2-amino-N-[(3-hydroxyphenyl)-thiophen-2-ylmethyl]-6-(3-methylbut-2-enyl)pyridine-3-carboxamide |
| SMILES | CC(C)=CCc1ccc(C(=O)NC(c2cccc(O)c2)c2cccs2)c(N)n1 |
| InChI | InChI=1S/C22H23N3O2S/c1-14(2)8-9-16-10-11-18(21(23)24-16)22(27)25-20(19-7-4-12-28-19)15-5-3-6-17(26)13-15/h3-8,10-13,20,26H,9H2,1-2H3,(H2,23,24)(H,25,27) |
| InChIKey | GACQVJMHHTUXTG-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|