C10H17N — CID 91397304
(6E)-2-ethyl-2-methyl-4,5-dihydro-3H-azocine (PubChem CID 91397304) has the molecular formula C10H17N and a molecular weight of 151.25 g/mol. Its IUPAC name is (6E)-2-ethyl-2-methyl-4,5-dihydro-3H-azocine.
| Compound Name | (6E)-2-ethyl-2-methyl-4,5-dihydro-3H-azocine |
|---|---|
| PubChem CID | 91397304 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | (6E)-2-ethyl-2-methyl-4,5-dihydro-3H-azocine |
| SMILES | CCC1(C)CCC/C=C\C=N/1 |
| InChI | InChI=1S/C10H17N/c1-3-10(2)8-6-4-5-7-9-11-10/h5,7,9H,3-4,6,8H2,1-2H3/b7-5-,11-9- |
| InChIKey | MLPDBRNLNSQQJG-CXHWBCNXSA-N |
| XLogP | 2.97 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |