C20H16N4O9 — CID 91397325
(2,5-dihydroxypyrrol-1-yl) 3-[(3,5-dinitrobenzoyl)amino]-3-phenylpropanoate (PubChem CID 91397325) has the molecular formula C20H16N4O9 and a molecular weight of 456.37 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 3-[(3,5-dinitrobenzoyl)amino]-3-phenylpropanoate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 3-[(3,5-dinitrobenzoyl)amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 91397325 |
| Molecular Formula | C20H16N4O9 |
| Molecular Weight | 456.37 g/mol |
| Exact Mass | 456.09 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 3-[(3,5-dinitrobenzoyl)amino]-3-phenylpropanoate |
| SMILES | O=C(CC(NC(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1)c1ccccc1)On1c(O)ccc1O |
| InChI | InChI=1S/C20H16N4O9/c25-17-6-7-18(26)22(17)33-19(27)11-16(12-4-2-1-3-5-12)21-20(28)13-8-14(23(29)30)10-15(9-13)24(31)32/h1-10,16,25-26H,11H2,(H,21,28) |
| InChIKey | IHAWRMWLKRXSDJ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 187.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.37 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|