C15H15FN4O3 — CID 91398668
2-[2-(dimethylamino)-2-oxoethoxy]-N-(4-fluorophenyl)pyrimidine-5-carboxamide (PubChem CID 91398668) has the molecular formula C15H15FN4O3 and a molecular weight of 318.31 g/mol. Its IUPAC name is 2-[2-(dimethylamino)-2-oxoethoxy]-N-(4-fluorophenyl)pyrimidine-5-carboxamide.
| Compound Name | 2-[2-(dimethylamino)-2-oxoethoxy]-N-(4-fluorophenyl)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 91398668 |
| Molecular Formula | C15H15FN4O3 |
| Molecular Weight | 318.31 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | 2-[2-(dimethylamino)-2-oxoethoxy]-N-(4-fluorophenyl)pyrimidine-5-carboxamide |
| SMILES | CN(C)C(=O)COc1ncc(C(=O)Nc2ccc(F)cc2)cn1 |
| InChI | InChI=1S/C15H15FN4O3/c1-20(2)13(21)9-23-15-17-7-10(8-18-15)14(22)19-12-5-3-11(16)4-6-12/h3-8H,9H2,1-2H3,(H,19,22) |
| InChIKey | ZIYWJCIUIXJBLM-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.31 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |