C15H15FN4O4 — CID 90948178
N-(4-fluorophenyl)-2-[2-[methoxy(methyl)amino]-2-oxoethoxy]pyrimidine-5-carboxamide (PubChem CID 90948178) has the molecular formula C15H15FN4O4 and a molecular weight of 334.31 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2-[2-[methoxy(methyl)amino]-2-oxoethoxy]pyrimidine-5-carboxamide.
| Compound Name | N-(4-fluorophenyl)-2-[2-[methoxy(methyl)amino]-2-oxoethoxy]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 90948178 |
| Molecular Formula | C15H15FN4O4 |
| Molecular Weight | 334.31 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | N-(4-fluorophenyl)-2-[2-[methoxy(methyl)amino]-2-oxoethoxy]pyrimidine-5-carboxamide |
| SMILES | CON(C)C(=O)COc1ncc(C(=O)Nc2ccc(F)cc2)cn1 |
| InChI | InChI=1S/C15H15FN4O4/c1-20(23-2)13(21)9-24-15-17-7-10(8-18-15)14(22)19-12-5-3-11(16)4-6-12/h3-8H,9H2,1-2H3,(H,19,22) |
| InChIKey | SRKQAOHSLIFNTD-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 93.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.31 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|