C13H16N2S — CID 91399687
(3-pent-2-ynylphenyl)methyl carbamimidothioate (PubChem CID 91399687) has the molecular formula C13H16N2S and a molecular weight of 232.35 g/mol. Its IUPAC name is (3-pent-2-ynylphenyl)methyl carbamimidothioate.
| Compound Name | (3-pent-2-ynylphenyl)methyl carbamimidothioate |
|---|---|
| PubChem CID | 91399687 |
| Molecular Formula | C13H16N2S |
| Molecular Weight | 232.35 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | (3-pent-2-ynylphenyl)methyl carbamimidothioate |
| SMILES | [H]/N=C(\N)SCc1cccc(CC#CCC)c1 |
| InChI | InChI=1S/C13H16N2S/c1-2-3-4-6-11-7-5-8-12(9-11)10-16-13(14)15/h5,7-9H,2,6,10H2,1H3,(H3,14,15) |
| InChIKey | PRFZPEPUOJBXAY-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.35 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|