C21H18Cl2N2O5S — CID 91403696
6-[5-[[5-(2,4-dichlorophenyl)furan-2-yl]methylidene]-4,6-dioxo-2-sulfanylidene-1,3-diazinan-1-yl]hexanoic acid (PubChem CID 91403696) has the molecular formula C21H18Cl2N2O5S and a molecular weight of 481.36 g/mol. Its IUPAC name is 6-[5-[[5-(2,4-dichlorophenyl)furan-2-yl]methylidene]-4,6-dioxo-2-sulfanylidene-1,3-diazinan-1-yl]hexanoic acid.
| Compound Name | 6-[5-[[5-(2,4-dichlorophenyl)furan-2-yl]methylidene]-4,6-dioxo-2-sulfanylidene-1,3-diazinan-1-yl]hexanoic acid |
|---|---|
| PubChem CID | 91403696 |
| Molecular Formula | C21H18Cl2N2O5S |
| Molecular Weight | 481.36 g/mol |
| Exact Mass | 480.03 |
| IUPAC Name | 6-[5-[[5-(2,4-dichlorophenyl)furan-2-yl]methylidene]-4,6-dioxo-2-sulfanylidene-1,3-diazinan-1-yl]hexanoic acid |
| SMILES | O=C(O)CCCCCN1C(=O)C(=Cc2ccc(-c3ccc(Cl)cc3Cl)o2)C(=O)NC1=S |
| InChI | InChI=1S/C21H18Cl2N2O5S/c22-12-5-7-14(16(23)10-12)17-8-6-13(30-17)11-15-19(28)24-21(31)25(20(15)29)9-3-1-2-4-18(26)27/h5-8,10-11H,1-4,9H2,(H,26,27)(H,24,28,31) |
| InChIKey | RQAVWCHOWLNRBG-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 99.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.36 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|