C25H27N3O6S — CID 91405936
1-[4-[3-(dimethylamino)-2-(4-methyl-N-sulfinoanilino)-3-oxopropyl]phenoxy]-3-(hydroxycarbamoyl)benzene (PubChem CID 91405936) has the molecular formula C25H27N3O6S and a molecular weight of 497.57 g/mol. Its IUPAC name is 1-[4-[3-(dimethylamino)-2-(4-methyl-N-sulfinoanilino)-3-oxopropyl]phenoxy]-3-(hydroxycarbamoyl)benzene.
| Compound Name | 1-[4-[3-(dimethylamino)-2-(4-methyl-N-sulfinoanilino)-3-oxopropyl]phenoxy]-3-(hydroxycarbamoyl)benzene |
|---|---|
| PubChem CID | 91405936 |
| Molecular Formula | C25H27N3O6S |
| Molecular Weight | 497.57 g/mol |
| Exact Mass | 497.16 |
| IUPAC Name | 1-[4-[3-(dimethylamino)-2-(4-methyl-N-sulfinoanilino)-3-oxopropyl]phenoxy]-3-(hydroxycarbamoyl)benzene |
| SMILES | Cc1ccc(N(C(Cc2ccc(Oc3cccc(C(=O)NO)c3)cc2)C(=O)N(C)C)S(=O)O)cc1 |
| InChI | InChI=1S/C25H27N3O6S/c1-17-7-11-20(12-8-17)28(35(32)33)23(25(30)27(2)3)15-18-9-13-21(14-10-18)34-22-6-4-5-19(16-22)24(29)26-31/h4-14,16,23,31H,15H2,1-3H3,(H,26,29)(H,32,33) |
| InChIKey | RXLGDXAVVXMASQ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 119.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.57 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|