C25H26N3O6S- — CID 91489850
1-[3-(dimethylamino)-2-(4-methyl-N-sulfinatoanilino)-3-oxopropyl]-3-[4-(hydroxycarbamoyl)phenoxy]benzene (PubChem CID 91489850) has the molecular formula C25H26N3O6S- and a molecular weight of 496.57 g/mol. Its IUPAC name is 1-[3-(dimethylamino)-2-(4-methyl-N-sulfinatoanilino)-3-oxopropyl]-3-[4-(hydroxycarbamoyl)phenoxy]benzene.
| Compound Name | 1-[3-(dimethylamino)-2-(4-methyl-N-sulfinatoanilino)-3-oxopropyl]-3-[4-(hydroxycarbamoyl)phenoxy]benzene |
|---|---|
| PubChem CID | 91489850 |
| Molecular Formula | C25H26N3O6S- |
| Molecular Weight | 496.57 g/mol |
| Exact Mass | 496.15 |
| IUPAC Name | 1-[3-(dimethylamino)-2-(4-methyl-N-sulfinatoanilino)-3-oxopropyl]-3-[4-(hydroxycarbamoyl)phenoxy]benzene |
| SMILES | Cc1ccc(N(C(Cc2cccc(Oc3ccc(C(=O)NO)cc3)c2)C(=O)N(C)C)S(=O)[O-])cc1 |
| InChI | InChI=1S/C25H27N3O6S/c1-17-7-11-20(12-8-17)28(35(32)33)23(25(30)27(2)3)16-18-5-4-6-22(15-18)34-21-13-9-19(10-14-21)24(29)26-31/h4-15,23,31H,16H2,1-3H3,(H,26,29)(H,32,33)/p-1 |
| InChIKey | JEFIKZIIVOVNME-UHFFFAOYSA-M |
| XLogP | 3.21 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.57 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|