C23H23N3O5S2-2 — CID 69358362
1-[[2-(benzylamino)-1-(4-methyl-N-sulfinatoanilino)-2-oxoethyl]-sulfinatoamino]-4-methylbenzene (PubChem CID 69358362) has the molecular formula C23H23N3O5S2-2 and a molecular weight of 485.59 g/mol. Its IUPAC name is 1-[[2-(benzylamino)-1-(4-methyl-N-sulfinatoanilino)-2-oxoethyl]-sulfinatoamino]-4-methylbenzene.
| Compound Name | 1-[[2-(benzylamino)-1-(4-methyl-N-sulfinatoanilino)-2-oxoethyl]-sulfinatoamino]-4-methylbenzene |
|---|---|
| PubChem CID | 69358362 |
| Molecular Formula | C23H23N3O5S2-2 |
| Molecular Weight | 485.59 g/mol |
| Exact Mass | 485.11 |
| IUPAC Name | 1-[[2-(benzylamino)-1-(4-methyl-N-sulfinatoanilino)-2-oxoethyl]-sulfinatoamino]-4-methylbenzene |
| SMILES | Cc1ccc(N(C(C(=O)NCc2ccccc2)N(c2ccc(C)cc2)S(=O)[O-])S(=O)[O-])cc1 |
| InChI | InChI=1S/C23H25N3O5S2/c1-17-8-12-20(13-9-17)25(32(28)29)23(22(27)24-16-19-6-4-3-5-7-19)26(33(30)31)21-14-10-18(2)11-15-21/h3-15,23H,16H2,1-2H3,(H,24,27)(H,28,29)(H,30,31)/p-2 |
| InChIKey | WZESMKVDYCPQBJ-UHFFFAOYSA-L |
| XLogP | 2.85 |
| TPSA | 115.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.59 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|