C4H3Br7 — CID 91407354
1,1,1,2,2,3,3-heptabromobutane (PubChem CID 91407354) has the molecular formula C4H3Br7 and a molecular weight of 610.40 g/mol. Its IUPAC name is 1,1,1,2,2,3,3-heptabromobutane.
| Compound Name | 1,1,1,2,2,3,3-heptabromobutane |
|---|---|
| PubChem CID | 91407354 |
| Molecular Formula | C4H3Br7 |
| Molecular Weight | 610.40 g/mol |
| Exact Mass | 603.45 |
| IUPAC Name | 1,1,1,2,2,3,3-heptabromobutane |
| SMILES | CC(Br)(Br)C(Br)(Br)C(Br)(Br)Br |
| InChI | InChI=1S/C4H3Br7/c1-2(5,6)3(7,8)4(9,10)11/h1H3 |
| InChIKey | RNALDIRMCFXNDL-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.40 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|