C30H20F12N2O4S2 — CID 91407807
1-[[1,2-diphenyl-2-[N-sulfino-3,5-bis(trifluoromethyl)anilino]ethyl]-sulfinoamino]-3,5-bis(trifluoromethyl)benzene (PubChem CID 91407807) has the molecular formula C30H20F12N2O4S2 and a molecular weight of 764.61 g/mol. Its IUPAC name is 1-[[1,2-diphenyl-2-[N-sulfino-3,5-bis(trifluoromethyl)anilino]ethyl]-sulfinoamino]-3,5-bis(trifluoromethyl)benzene.
| Compound Name | 1-[[1,2-diphenyl-2-[N-sulfino-3,5-bis(trifluoromethyl)anilino]ethyl]-sulfinoamino]-3,5-bis(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 91407807 |
| Molecular Formula | C30H20F12N2O4S2 |
| Molecular Weight | 764.61 g/mol |
| Exact Mass | 764.07 |
| IUPAC Name | 1-[[1,2-diphenyl-2-[N-sulfino-3,5-bis(trifluoromethyl)anilino]ethyl]-sulfinoamino]-3,5-bis(trifluoromethyl)benzene |
| SMILES | O=S(O)N(c1cc(C(F)(F)F)cc(C(F)(F)F)c1)C(c1ccccc1)C(c1ccccc1)N(c1cc(C(F)(F)F)cc(C(F)(F)F)c1)S(=O)O |
| InChI | InChI=1S/C30H20F12N2O4S2/c31-27(32,33)19-11-20(28(34,35)36)14-23(13-19)43(49(45)46)25(17-7-3-1-4-8-17)26(18-9-5-2-6-10-18)44(50(47)48)24-15-21(29(37,38)39)12-22(16-24)30(40,41)42/h1-16,25-26H,(H,45,46)(H,47,48) |
| InChIKey | DKFXUDAOFYMBOH-UHFFFAOYSA-N |
| XLogP | 9.83 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 764.61 |
| LogP ≤ 5 | 9.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|