C29H24F4 — CID 91411014
2-fluoro-1-(4-methylphenyl)-4-[4-(4-propylphenyl)-3-(trifluoromethyl)phenyl]benzene (PubChem CID 91411014) has the molecular formula C29H24F4 and a molecular weight of 448.50 g/mol. Its IUPAC name is 2-fluoro-1-(4-methylphenyl)-4-[4-(4-propylphenyl)-3-(trifluoromethyl)phenyl]benzene.
| Compound Name | 2-fluoro-1-(4-methylphenyl)-4-[4-(4-propylphenyl)-3-(trifluoromethyl)phenyl]benzene |
|---|---|
| PubChem CID | 91411014 |
| Molecular Formula | C29H24F4 |
| Molecular Weight | 448.50 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | 2-fluoro-1-(4-methylphenyl)-4-[4-(4-propylphenyl)-3-(trifluoromethyl)phenyl]benzene |
| SMILES | CCCc1ccc(-c2ccc(-c3ccc(-c4ccc(C)cc4)c(F)c3)cc2C(F)(F)F)cc1 |
| InChI | InChI=1S/C29H24F4/c1-3-4-20-7-11-21(12-8-20)25-15-13-23(17-27(25)29(31,32)33)24-14-16-26(28(30)18-24)22-9-5-19(2)6-10-22/h5-18H,3-4H2,1-2H3 |
| InChIKey | MQLIBFLSZRBOGG-UHFFFAOYSA-N |
| XLogP | 9.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.50 |
| LogP ≤ 5 | 9.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |