C36H36N6O4 — CID 91411390
3-[(Z)-N-(1-aminoethylideneamino)-C-methylcarbonimidoyl]-N-[2-[[(2S)-2-[(4-benzoylbenzoyl)amino]-3-phenylpropanoyl]amino]ethyl]benzamide (PubChem CID 91411390) has the molecular formula C36H36N6O4 and a molecular weight of 616.72 g/mol. Its IUPAC name is 3-[(Z)-N-(1-aminoethylideneamino)-C-methylcarbonimidoyl]-N-[2-[[(2S)-2-[(4-benzoylbenzoyl)amino]-3-phenylpropanoyl]amino]ethyl]benzamide.
| Compound Name | 3-[(Z)-N-(1-aminoethylideneamino)-C-methylcarbonimidoyl]-N-[2-[[(2S)-2-[(4-benzoylbenzoyl)amino]-3-phenylpropanoyl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 91411390 |
| Molecular Formula | C36H36N6O4 |
| Molecular Weight | 616.72 g/mol |
| Exact Mass | 616.28 |
| IUPAC Name | 3-[(Z)-N-(1-aminoethylideneamino)-C-methylcarbonimidoyl]-N-[2-[[(2S)-2-[(4-benzoylbenzoyl)amino]-3-phenylpropanoyl]amino]ethyl]benzamide |
| SMILES | CC(N)=N/N=C(/C)c1cccc(C(=O)NCCNC(=O)[C@H](Cc2ccccc2)NC(=O)c2ccc(C(=O)c3ccccc3)cc2)c1 |
| InChI | InChI=1S/C36H36N6O4/c1-24(41-42-25(2)37)30-14-9-15-31(23-30)34(44)38-20-21-39-36(46)32(22-26-10-5-3-6-11-26)40-35(45)29-18-16-28(17-19-29)33(43)27-12-7-4-8-13-27/h3-19,23,32H,20-22H2,1-2H3,(H2,37,42)(H,38,44)(H,39,46)(H,40,45)/b41-24-/t32-/m0/s1 |
| InChIKey | IDOZRYZRQUKVIK-XFTXYQCMSA-N |
| XLogP | 3.91 |
| TPSA | 155.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.72 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|