C23H16Br2O4 — CID 91414302
[3,5-dibromo-4-[(2-phenyl-1-benzofuran-5-yl)oxy]phenyl] propanoate (PubChem CID 91414302) has the molecular formula C23H16Br2O4 and a molecular weight of 516.19 g/mol. Its IUPAC name is [3,5-dibromo-4-[(2-phenyl-1-benzofuran-5-yl)oxy]phenyl] propanoate.
| Compound Name | [3,5-dibromo-4-[(2-phenyl-1-benzofuran-5-yl)oxy]phenyl] propanoate |
|---|---|
| PubChem CID | 91414302 |
| Molecular Formula | C23H16Br2O4 |
| Molecular Weight | 516.19 g/mol |
| Exact Mass | 513.94 |
| IUPAC Name | [3,5-dibromo-4-[(2-phenyl-1-benzofuran-5-yl)oxy]phenyl] propanoate |
| SMILES | CCC(=O)Oc1cc(Br)c(Oc2ccc3oc(-c4ccccc4)cc3c2)c(Br)c1 |
| InChI | InChI=1S/C23H16Br2O4/c1-2-22(26)27-17-12-18(24)23(19(25)13-17)28-16-8-9-20-15(10-16)11-21(29-20)14-6-4-3-5-7-14/h3-13H,2H2,1H3 |
| InChIKey | FTGFFEGCROPEJF-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.19 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|