C12H19N — CID 91416209
N-[(2E,4Z)-hexa-2,4-dien-3-yl]-3-methylpent-2-en-1-imine (PubChem CID 91416209) has the molecular formula C12H19N and a molecular weight of 177.29 g/mol. Its IUPAC name is N-[(2E,4Z)-hexa-2,4-dien-3-yl]-3-methylpent-2-en-1-imine.
| Compound Name | N-[(2E,4Z)-hexa-2,4-dien-3-yl]-3-methylpent-2-en-1-imine |
|---|---|
| PubChem CID | 91416209 |
| Molecular Formula | C12H19N |
| Molecular Weight | 177.29 g/mol |
| Exact Mass | 177.15 |
| IUPAC Name | N-[(2E,4Z)-hexa-2,4-dien-3-yl]-3-methylpent-2-en-1-imine |
| SMILES | C/C=C\C(=C/C)\N=C\C=C(C)CC |
| InChI | InChI=1S/C12H19N/c1-5-8-12(7-3)13-10-9-11(4)6-2/h5,7-10H,6H2,1-4H3/b8-5-,11-9?,12-7+,13-10+ |
| InChIKey | LBULYDPBKJSNPY-SMYQDJCASA-N |
| XLogP | 3.89 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.29 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|