C23H25F3N4O2 — CID 91417102
N-[2-(aziridin-1-yl)ethyl]-6-[4-[2-(trifluoromethyl)benzoyl]cyclohexyl]pyridazine-3-carboxamide (PubChem CID 91417102) has the molecular formula C23H25F3N4O2 and a molecular weight of 446.47 g/mol. Its IUPAC name is N-[2-(aziridin-1-yl)ethyl]-6-[4-[2-(trifluoromethyl)benzoyl]cyclohexyl]pyridazine-3-carboxamide.
| Compound Name | N-[2-(aziridin-1-yl)ethyl]-6-[4-[2-(trifluoromethyl)benzoyl]cyclohexyl]pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 91417102 |
| Molecular Formula | C23H25F3N4O2 |
| Molecular Weight | 446.47 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | N-[2-(aziridin-1-yl)ethyl]-6-[4-[2-(trifluoromethyl)benzoyl]cyclohexyl]pyridazine-3-carboxamide |
| SMILES | O=C(NCCN1CC1)c1ccc(C2CCC(C(=O)c3ccccc3C(F)(F)F)CC2)nn1 |
| InChI | InChI=1S/C23H25F3N4O2/c24-23(25,26)18-4-2-1-3-17(18)21(31)16-7-5-15(6-8-16)19-9-10-20(29-28-19)22(32)27-11-12-30-13-14-30/h1-4,9-10,15-16H,5-8,11-14H2,(H,27,32) |
| InChIKey | AWGVAYPONKCVRW-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 74.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.47 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|