C26H32F3N3O2 — CID 69397935
N-heptyl-6-[4-[2-(trifluoromethyl)benzoyl]cyclohexyl]pyridazine-3-carboxamide (PubChem CID 69397935) has the molecular formula C26H32F3N3O2 and a molecular weight of 475.56 g/mol. Its IUPAC name is N-heptyl-6-[4-[2-(trifluoromethyl)benzoyl]cyclohexyl]pyridazine-3-carboxamide.
| Compound Name | N-heptyl-6-[4-[2-(trifluoromethyl)benzoyl]cyclohexyl]pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 69397935 |
| Molecular Formula | C26H32F3N3O2 |
| Molecular Weight | 475.56 g/mol |
| Exact Mass | 475.24 |
| IUPAC Name | N-heptyl-6-[4-[2-(trifluoromethyl)benzoyl]cyclohexyl]pyridazine-3-carboxamide |
| SMILES | CCCCCCCNC(=O)c1ccc(C2CCC(C(=O)c3ccccc3C(F)(F)F)CC2)nn1 |
| InChI | InChI=1S/C26H32F3N3O2/c1-2-3-4-5-8-17-30-25(34)23-16-15-22(31-32-23)18-11-13-19(14-12-18)24(33)20-9-6-7-10-21(20)26(27,28)29/h6-7,9-10,15-16,18-19H,2-5,8,11-14,17H2,1H3,(H,30,34) |
| InChIKey | OAZUDTGAIANDTD-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.56 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|