C16H15N3O5S — CID 91417919
2-hydroxy-4-[[N-(2-methylprop-2-enoyl)anilino]diazenyl]benzenesulfonic acid (PubChem CID 91417919) has the molecular formula C16H15N3O5S and a molecular weight of 361.38 g/mol. Its IUPAC name is 2-hydroxy-4-[[N-(2-methylprop-2-enoyl)anilino]diazenyl]benzenesulfonic acid.
| Compound Name | 2-hydroxy-4-[[N-(2-methylprop-2-enoyl)anilino]diazenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 91417919 |
| Molecular Formula | C16H15N3O5S |
| Molecular Weight | 361.38 g/mol |
| Exact Mass | 361.07 |
| IUPAC Name | 2-hydroxy-4-[[N-(2-methylprop-2-enoyl)anilino]diazenyl]benzenesulfonic acid |
| SMILES | C=C(C)C(=O)N(/N=N/c1ccc(S(=O)(=O)O)c(O)c1)c1ccccc1 |
| InChI | InChI=1S/C16H15N3O5S/c1-11(2)16(21)19(13-6-4-3-5-7-13)18-17-12-8-9-15(14(20)10-12)25(22,23)24/h3-10,20H,1H2,2H3,(H,22,23,24)/b18-17+ |
| InChIKey | CYVSZSPUJBQGCZ-ISLYRVAYSA-N |
| XLogP | 3.25 |
| TPSA | 119.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.38 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|