C23H27O3S- — CID 91418271
2-[2,3-dimethyl-4-(2-phenylethyl)phenyl]furan;propane-2-sulfinate (PubChem CID 91418271) has the molecular formula C23H27O3S- and a molecular weight of 383.53 g/mol. Its IUPAC name is 2-[2,3-dimethyl-4-(2-phenylethyl)phenyl]furan;propane-2-sulfinate.
| Compound Name | 2-[2,3-dimethyl-4-(2-phenylethyl)phenyl]furan;propane-2-sulfinate |
|---|---|
| PubChem CID | 91418271 |
| Molecular Formula | C23H27O3S- |
| Molecular Weight | 383.53 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | 2-[2,3-dimethyl-4-(2-phenylethyl)phenyl]furan;propane-2-sulfinate |
| SMILES | CC(C)S(=O)[O-].Cc1c(CCc2ccccc2)ccc(-c2ccco2)c1C |
| InChI | InChI=1S/C20H20O.C3H8O2S/c1-15-16(2)19(20-9-6-14-21-20)13-12-18(15)11-10-17-7-4-3-5-8-17;1-3(2)6(4)5/h3-9,12-14H,10-11H2,1-2H3;3H,1-2H3,(H,4,5)/p-1 |
| InChIKey | QMWJYLZDENKEQE-UHFFFAOYSA-M |
| XLogP | 5.62 |
| TPSA | 53.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.53 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|