C27H41NO8 — CID 91418691
[(2S)-1-[(2S)-2-amino-3-[3,4-bis(2-methylbutanoyloxy)phenyl]propanoyl]oxypropan-2-yl] pentanoate (PubChem CID 91418691) has the molecular formula C27H41NO8 and a molecular weight of 507.62 g/mol. Its IUPAC name is [(2S)-1-[(2S)-2-amino-3-[3,4-bis(2-methylbutanoyloxy)phenyl]propanoyl]oxypropan-2-yl] pentanoate.
| Compound Name | [(2S)-1-[(2S)-2-amino-3-[3,4-bis(2-methylbutanoyloxy)phenyl]propanoyl]oxypropan-2-yl] pentanoate |
|---|---|
| PubChem CID | 91418691 |
| Molecular Formula | C27H41NO8 |
| Molecular Weight | 507.62 g/mol |
| Exact Mass | 507.28 |
| IUPAC Name | [(2S)-1-[(2S)-2-amino-3-[3,4-bis(2-methylbutanoyloxy)phenyl]propanoyl]oxypropan-2-yl] pentanoate |
| SMILES | CCCCC(=O)O[C@@H](C)COC(=O)[C@@H](N)Cc1ccc(OC(=O)C(C)CC)c(OC(=O)C(C)CC)c1 |
| InChI | InChI=1S/C27H41NO8/c1-7-10-11-24(29)34-19(6)16-33-27(32)21(28)14-20-12-13-22(35-25(30)17(4)8-2)23(15-20)36-26(31)18(5)9-3/h12-13,15,17-19,21H,7-11,14,16,28H2,1-6H3/t17?,18?,19-,21-/m0/s1 |
| InChIKey | VDPASBVMTPOZIX-XSNSTOHYSA-N |
| XLogP | 4.12 |
| TPSA | 131.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.62 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|