C20H19N5O2S — CID 91419349
4-[(4-ethyl-3-oxo-2H-quinoxalin-1-yl)amino]-N-(1,3-thiazol-2-yl)benzamide (PubChem CID 91419349) has the molecular formula C20H19N5O2S and a molecular weight of 393.47 g/mol. Its IUPAC name is 4-[(4-ethyl-3-oxo-2H-quinoxalin-1-yl)amino]-N-(1,3-thiazol-2-yl)benzamide.
| Compound Name | 4-[(4-ethyl-3-oxo-2H-quinoxalin-1-yl)amino]-N-(1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 91419349 |
| Molecular Formula | C20H19N5O2S |
| Molecular Weight | 393.47 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | 4-[(4-ethyl-3-oxo-2H-quinoxalin-1-yl)amino]-N-(1,3-thiazol-2-yl)benzamide |
| SMILES | CCN1C(=O)CN(Nc2ccc(C(=O)Nc3nccs3)cc2)c2ccccc21 |
| InChI | InChI=1S/C20H19N5O2S/c1-2-24-16-5-3-4-6-17(16)25(13-18(24)26)23-15-9-7-14(8-10-15)19(27)22-20-21-11-12-28-20/h3-12,23H,2,13H2,1H3,(H,21,22,27) |
| InChIKey | RXVLMUURXAEFAC-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 77.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.47 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |