C26H27NO5 — CID 91421872
ethyl 2-[4-(4,9-diethoxy-3-hydroxybenzo[f]isoindol-2-yl)phenyl]acetate (PubChem CID 91421872) has the molecular formula C26H27NO5 and a molecular weight of 433.50 g/mol. Its IUPAC name is ethyl 2-[4-(4,9-diethoxy-3-hydroxybenzo[f]isoindol-2-yl)phenyl]acetate.
| Compound Name | ethyl 2-[4-(4,9-diethoxy-3-hydroxybenzo[f]isoindol-2-yl)phenyl]acetate |
|---|---|
| PubChem CID | 91421872 |
| Molecular Formula | C26H27NO5 |
| Molecular Weight | 433.50 g/mol |
| Exact Mass | 433.19 |
| IUPAC Name | ethyl 2-[4-(4,9-diethoxy-3-hydroxybenzo[f]isoindol-2-yl)phenyl]acetate |
| SMILES | CCOC(=O)Cc1ccc(-n2cc3c(OCC)c4ccccc4c(OCC)c3c2O)cc1 |
| InChI | InChI=1S/C26H27NO5/c1-4-30-22(28)15-17-11-13-18(14-12-17)27-16-21-23(26(27)29)25(32-6-3)20-10-8-7-9-19(20)24(21)31-5-2/h7-14,16,29H,4-6,15H2,1-3H3 |
| InChIKey | SHKJEGTUTWMRGG-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.50 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |