C23H18ClNO4 — CID 90984909
2-[4-(4-chloro-1-hydroxy-7-phenylmethoxyisoindol-2-yl)phenyl]acetic acid (PubChem CID 90984909) has the molecular formula C23H18ClNO4 and a molecular weight of 407.85 g/mol. Its IUPAC name is 2-[4-(4-chloro-1-hydroxy-7-phenylmethoxyisoindol-2-yl)phenyl]acetic acid.
| Compound Name | 2-[4-(4-chloro-1-hydroxy-7-phenylmethoxyisoindol-2-yl)phenyl]acetic acid |
|---|---|
| PubChem CID | 90984909 |
| Molecular Formula | C23H18ClNO4 |
| Molecular Weight | 407.85 g/mol |
| Exact Mass | 407.09 |
| IUPAC Name | 2-[4-(4-chloro-1-hydroxy-7-phenylmethoxyisoindol-2-yl)phenyl]acetic acid |
| SMILES | O=C(O)Cc1ccc(-n2cc3c(Cl)ccc(OCc4ccccc4)c3c2O)cc1 |
| InChI | InChI=1S/C23H18ClNO4/c24-19-10-11-20(29-14-16-4-2-1-3-5-16)22-18(19)13-25(23(22)28)17-8-6-15(7-9-17)12-21(26)27/h1-11,13,28H,12,14H2,(H,26,27) |
| InChIKey | DTWUROYZUJZZJQ-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.85 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |