C21H27F — CID 91423755
5-benzyl-1,3-dibutyl-2-fluorobenzene (PubChem CID 91423755) has the molecular formula C21H27F and a molecular weight of 298.44 g/mol. Its IUPAC name is 5-benzyl-1,3-dibutyl-2-fluorobenzene.
| Compound Name | 5-benzyl-1,3-dibutyl-2-fluorobenzene |
|---|---|
| PubChem CID | 91423755 |
| Molecular Formula | C21H27F |
| Molecular Weight | 298.44 g/mol |
| Exact Mass | 298.21 |
| IUPAC Name | 5-benzyl-1,3-dibutyl-2-fluorobenzene |
| SMILES | CCCCc1cc(Cc2ccccc2)cc(CCCC)c1F |
| InChI | InChI=1S/C21H27F/c1-3-5-12-19-15-18(14-17-10-8-7-9-11-17)16-20(21(19)22)13-6-4-2/h7-11,15-16H,3-6,12-14H2,1-2H3 |
| InChIKey | VPZGNCGUFHYQNO-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.44 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |