C8H14N2 — CID 91424405
N,N-dimethyl-6-methylidene-2,5-dihydropyridin-1-amine (PubChem CID 91424405) has the molecular formula C8H14N2 and a molecular weight of 138.21 g/mol. Its IUPAC name is N,N-dimethyl-6-methylidene-2,5-dihydropyridin-1-amine.
| Compound Name | N,N-dimethyl-6-methylidene-2,5-dihydropyridin-1-amine |
|---|---|
| PubChem CID | 91424405 |
| Molecular Formula | C8H14N2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.12 |
| IUPAC Name | N,N-dimethyl-6-methylidene-2,5-dihydropyridin-1-amine |
| SMILES | C=C1CC=CCN1N(C)C |
| InChI | InChI=1S/C8H14N2/c1-8-6-4-5-7-10(8)9(2)3/h4-5H,1,6-7H2,2-3H3 |
| InChIKey | DYYQRLRDKASFPX-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|