C18H35N7O5 — CID 91424643
(2S,3S)-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-N-[(2S,3S)-3-hydroxy-1-oxo-1-(2-oxoethylamino)butan-2-yl]-3-methylpentanamide (PubChem CID 91424643) has the molecular formula C18H35N7O5 and a molecular weight of 429.52 g/mol. Its IUPAC name is (2S,3S)-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-N-[(2S,3S)-3-hydroxy-1-oxo-1-(2-oxoethylamino)butan-2-yl]-3-methylpentanamide.
| Compound Name | (2S,3S)-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-N-[(2S,3S)-3-hydroxy-1-oxo-1-(2-oxoethylamino)butan-2-yl]-3-methylpentanamide |
|---|---|
| PubChem CID | 91424643 |
| Molecular Formula | C18H35N7O5 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.27 |
| IUPAC Name | (2S,3S)-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-N-[(2S,3S)-3-hydroxy-1-oxo-1-(2-oxoethylamino)butan-2-yl]-3-methylpentanamide |
| SMILES | CC[C@H](C)[C@H](NC(=O)[C@@H](N)CCCN=C(N)N)C(=O)N[C@H](C(=O)NCC=O)[C@H](C)O |
| InChI | InChI=1S/C18H35N7O5/c1-4-10(2)13(24-15(28)12(19)6-5-7-23-18(20)21)17(30)25-14(11(3)27)16(29)22-8-9-26/h9-14,27H,4-8,19H2,1-3H3,(H,22,29)(H,24,28)(H,25,30)(H4,20,21,23)/t10-,11-,12-,13-,14-/m0/s1 |
| InChIKey | SZNSHVGXFRLBPB-PEDHHIEDSA-N |
| XLogP | -2.92 |
| TPSA | 215.02 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | -2.92 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|