C12H29N3O2 — CID 91426007
N'-ethyl-N-[3-[ethyl(methoxy)amino]propyl]-N'-methoxypropane-1,3-diamine (PubChem CID 91426007) has the molecular formula C12H29N3O2 and a molecular weight of 247.38 g/mol. Its IUPAC name is N'-ethyl-N-[3-[ethyl(methoxy)amino]propyl]-N'-methoxypropane-1,3-diamine.
| Compound Name | N'-ethyl-N-[3-[ethyl(methoxy)amino]propyl]-N'-methoxypropane-1,3-diamine |
|---|---|
| PubChem CID | 91426007 |
| Molecular Formula | C12H29N3O2 |
| Molecular Weight | 247.38 g/mol |
| Exact Mass | 247.23 |
| IUPAC Name | N'-ethyl-N-[3-[ethyl(methoxy)amino]propyl]-N'-methoxypropane-1,3-diamine |
| SMILES | CCN(CCCNCCCN(CC)OC)OC |
| InChI | InChI=1S/C12H29N3O2/c1-5-14(16-3)11-7-9-13-10-8-12-15(6-2)17-4/h13H,5-12H2,1-4H3 |
| InChIKey | MIIXFBJCQCTSOM-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 36.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.38 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|