C12H24O — CID 91426806
4-ethenyl-1-methoxy-3-methyloctane (PubChem CID 91426806) has the molecular formula C12H24O and a molecular weight of 184.32 g/mol. Its IUPAC name is 4-ethenyl-1-methoxy-3-methyloctane.
| Compound Name | 4-ethenyl-1-methoxy-3-methyloctane |
|---|---|
| PubChem CID | 91426806 |
| Molecular Formula | C12H24O |
| Molecular Weight | 184.32 g/mol |
| Exact Mass | 184.18 |
| IUPAC Name | 4-ethenyl-1-methoxy-3-methyloctane |
| SMILES | C=CC(CCCC)C(C)CCOC |
| InChI | InChI=1S/C12H24O/c1-5-7-8-12(6-2)11(3)9-10-13-4/h6,11-12H,2,5,7-10H2,1,3-4H3 |
| InChIKey | XFTXZFUYQPDHKD-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.32 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|