C24H29NS — CID 91429169
ethane;3-thia-19-azapentacyclo[11.7.0.02,10.04,9.014,19]icosa-1(20),2(10),4,6,8,11,13,15,17-nonaene (PubChem CID 91429169) has the molecular formula C24H29NS and a molecular weight of 363.57 g/mol. Its IUPAC name is ethane;3-thia-19-azapentacyclo[11.7.0.02,10.04,9.014,19]icosa-1(20),2(10),4,6,8,11,13,15,17-nonaene.
| Compound Name | ethane;3-thia-19-azapentacyclo[11.7.0.02,10.04,9.014,19]icosa-1(20),2(10),4,6,8,11,13,15,17-nonaene |
|---|---|
| PubChem CID | 91429169 |
| Molecular Formula | C24H29NS |
| Molecular Weight | 363.57 g/mol |
| Exact Mass | 363.20 |
| IUPAC Name | ethane;3-thia-19-azapentacyclo[11.7.0.02,10.04,9.014,19]icosa-1(20),2(10),4,6,8,11,13,15,17-nonaene |
| SMILES | CC.CC.CC.c1ccc2c(c1)sc1c2ccc2c1cn1ccccc21 |
| InChI | InChI=1S/C18H11NS.3C2H6/c1-2-7-17-13(5-1)14-9-8-12-15(18(14)20-17)11-19-10-4-3-6-16(12)19;3*1-2/h1-11H;3*1-2H3 |
| InChIKey | ALLWBGPWOXVNMI-UHFFFAOYSA-N |
| XLogP | 8.54 |
| TPSA | 4.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.57 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |