C18H22O2 — CID 91430749
1,3-bis(hex-3-ynoxy)benzene (PubChem CID 91430749) has the molecular formula C18H22O2 and a molecular weight of 270.37 g/mol. Its IUPAC name is 1,3-bis(hex-3-ynoxy)benzene.
| Compound Name | 1,3-bis(hex-3-ynoxy)benzene |
|---|---|
| PubChem CID | 91430749 |
| Molecular Formula | C18H22O2 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | 1,3-bis(hex-3-ynoxy)benzene |
| SMILES | CCC#CCCOc1cccc(OCCC#CCC)c1 |
| InChI | InChI=1S/C18H22O2/c1-3-5-7-9-14-19-17-12-11-13-18(16-17)20-15-10-8-6-4-2/h11-13,16H,3-4,9-10,14-15H2,1-2H3 |
| InChIKey | HAGRPRXHCFTBCH-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|