About 3-pent-2-ynoxyaniline
3-pent-2-ynoxyaniline (PubChem CID 45091199) has the molecular formula C11H13NO
and a molecular weight of 175.23 g/mol. Its IUPAC name is 3-pent-2-ynoxyaniline.
Molecular Properties
| Compound Name | 3-pent-2-ynoxyaniline |
| PubChem CID | 45091199 |
| Molecular Formula | C11H13NO |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | 3-pent-2-ynoxyaniline |
| SMILES | CCC#CCOc1cccc(N)c1 |
| InChI | InChI=1S/C11H13NO/c1-2-3-4-8-13-11-7-5-6-10(12)9-11/h5-7,9H,2,8,12H2,1H3 |
| InChIKey | WDVYLZYBCPMVLM-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-pent-2-ynoxyaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-pent-2-ynoxyaniline?
The IUPAC name of 3-pent-2-ynoxyaniline (CID 45091199) is 3-pent-2-ynoxyaniline.
What is the SMILES notation for 3-pent-2-ynoxyaniline?
The canonical SMILES for 3-pent-2-ynoxyaniline is CCC#CCOc1cccc(N)c1.
What is the InChIKey of 3-pent-2-ynoxyaniline?
The InChIKey is WDVYLZYBCPMVLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO/c1-2-3-4-8-13-11-7-5-6-10(12)9-11/h5-7,9H,2,8,12H2,1H3.
What are the key properties of 3-pent-2-ynoxyaniline?
3-pent-2-ynoxyaniline has a molecular weight of 175.23 g/mol, XLogP of 2.06, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-pent-2-ynoxyaniline is sourced from PubChem (CID 45091199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).