C28H18N2O2S+2 — CID 91431727
spiro[12H-indolo[1,2-c][1,3]benzoxazin-7-ium-6,6'-[1,3]benzothiazolo[3,2-c][1,3]benzoxazin-7-ium] (PubChem CID 91431727) has the molecular formula C28H18N2O2S+2 and a molecular weight of 446.53 g/mol. Its IUPAC name is spiro[12H-indolo[1,2-c][1,3]benzoxazin-7-ium-6,6'-[1,3]benzothiazolo[3,2-c][1,3]benzoxazin-7-ium].
| Compound Name | spiro[12H-indolo[1,2-c][1,3]benzoxazin-7-ium-6,6'-[1,3]benzothiazolo[3,2-c][1,3]benzoxazin-7-ium] |
|---|---|
| PubChem CID | 91431727 |
| Molecular Formula | C28H18N2O2S+2 |
| Molecular Weight | 446.53 g/mol |
| Exact Mass | 446.11 |
| IUPAC Name | spiro[12H-indolo[1,2-c][1,3]benzoxazin-7-ium-6,6'-[1,3]benzothiazolo[3,2-c][1,3]benzoxazin-7-ium] |
| SMILES | c1ccc2c(c1)CC1=[N+]2C2(Oc3ccccc31)Oc1ccccc1-c1sc3ccccc3[n+]12 |
| InChI | InChI=1S/C28H18N2O2S/c1-4-12-21-18(9-1)17-23-19-10-2-6-14-24(19)31-28(29(21)23)30-22-13-5-8-16-26(22)33-27(30)20-11-3-7-15-25(20)32-28/h1-16H,17H2/q+2 |
| InChIKey | YPVVHJDYJHBNHW-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 25.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.53 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|