C13H20N2 — CID 91432445
N-[3-(4-methyl-3H-azepin-7-yl)propyl]cyclopropanamine (PubChem CID 91432445) has the molecular formula C13H20N2 and a molecular weight of 204.32 g/mol. Its IUPAC name is N-[3-(4-methyl-3H-azepin-7-yl)propyl]cyclopropanamine.
| Compound Name | N-[3-(4-methyl-3H-azepin-7-yl)propyl]cyclopropanamine |
|---|---|
| PubChem CID | 91432445 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | N-[3-(4-methyl-3H-azepin-7-yl)propyl]cyclopropanamine |
| SMILES | CC1=CC=C(CCCNC2CC2)N=CC1 |
| InChI | InChI=1S/C13H20N2/c1-11-4-5-12(15-10-8-11)3-2-9-14-13-6-7-13/h4-5,10,13-14H,2-3,6-9H2,1H3 |
| InChIKey | CMLMXPPHDGNVRP-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|