C13H23N3 — CID 144588465
(E)-3-N-cyclopropyl-2-[(Z)-1-iminopent-2-en-2-yl]-1-N-methylbut-1-ene-1,3-diamine (PubChem CID 144588465) has the molecular formula C13H23N3 and a molecular weight of 221.35 g/mol. Its IUPAC name is (E)-3-N-cyclopropyl-2-[(Z)-1-iminopent-2-en-2-yl]-1-N-methylbut-1-ene-1,3-diamine.
| Compound Name | (E)-3-N-cyclopropyl-2-[(Z)-1-iminopent-2-en-2-yl]-1-N-methylbut-1-ene-1,3-diamine |
|---|---|
| PubChem CID | 144588465 |
| Molecular Formula | C13H23N3 |
| Molecular Weight | 221.35 g/mol |
| Exact Mass | 221.19 |
| IUPAC Name | (E)-3-N-cyclopropyl-2-[(Z)-1-iminopent-2-en-2-yl]-1-N-methylbut-1-ene-1,3-diamine |
| SMILES | [H]/N=C/C(=C\CC)/C(=C\NC)C(C)NC1CC1 |
| InChI | InChI=1S/C13H23N3/c1-4-5-11(8-14)13(9-15-3)10(2)16-12-6-7-12/h5,8-10,12,14-16H,4,6-7H2,1-3H3/b11-5+,13-9-,14-8+ |
| InChIKey | NVEVYSKOQBLMHF-ISCPWEHMSA-N |
| XLogP | 2.22 |
| TPSA | 47.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.35 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|