C14H25N3 — CID 144588383
(E)-3-N-cyclopropyl-2-[(Z)-1-iminopent-2-en-2-yl]-1-N,3-N-dimethylbut-1-ene-1,3-diamine (PubChem CID 144588383) has the molecular formula C14H25N3 and a molecular weight of 235.38 g/mol. Its IUPAC name is (E)-3-N-cyclopropyl-2-[(Z)-1-iminopent-2-en-2-yl]-1-N,3-N-dimethylbut-1-ene-1,3-diamine.
| Compound Name | (E)-3-N-cyclopropyl-2-[(Z)-1-iminopent-2-en-2-yl]-1-N,3-N-dimethylbut-1-ene-1,3-diamine |
|---|---|
| PubChem CID | 144588383 |
| Molecular Formula | C14H25N3 |
| Molecular Weight | 235.38 g/mol |
| Exact Mass | 235.20 |
| IUPAC Name | (E)-3-N-cyclopropyl-2-[(Z)-1-iminopent-2-en-2-yl]-1-N,3-N-dimethylbut-1-ene-1,3-diamine |
| SMILES | [H]/N=C/C(=C\CC)/C(=C\NC)C(C)N(C)C1CC1 |
| InChI | InChI=1S/C14H25N3/c1-5-6-12(9-15)14(10-16-3)11(2)17(4)13-7-8-13/h6,9-11,13,15-16H,5,7-8H2,1-4H3/b12-6+,14-10-,15-9+ |
| InChIKey | WCBOQCAYNDIVNU-WNCUJEHGSA-N |
| XLogP | 2.56 |
| TPSA | 39.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.38 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|