C9H16N4 — CID 142514401
(1E,3E)-3-N-cyclopropyl-2-methanimidoylpenta-1,3-diene-1,3,4-triamine (PubChem CID 142514401) has the molecular formula C9H16N4 and a molecular weight of 180.25 g/mol. Its IUPAC name is (1E,3E)-3-N-cyclopropyl-2-methanimidoylpenta-1,3-diene-1,3,4-triamine.
| Compound Name | (1E,3E)-3-N-cyclopropyl-2-methanimidoylpenta-1,3-diene-1,3,4-triamine |
|---|---|
| PubChem CID | 142514401 |
| Molecular Formula | C9H16N4 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.14 |
| IUPAC Name | (1E,3E)-3-N-cyclopropyl-2-methanimidoylpenta-1,3-diene-1,3,4-triamine |
| SMILES | [H]/N=C/C(=C/N)/C(NC1CC1)=C(/C)N |
| InChI | InChI=1S/C9H16N4/c1-6(12)9(7(4-10)5-11)13-8-2-3-8/h4-5,8,10,13H,2-3,11-12H2,1H3/b7-5-,9-6+,10-4+ |
| InChIKey | DKQXCKBYWCZEQT-UTMQBHNESA-N |
| XLogP | 0.42 |
| TPSA | 87.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|